C12H13ClN2O2 — CID 84742117
4-(1-chloro-5-methylimidazo[1,5-a]pyridin-3-yl)butanoic acid (PubChem CID 84742117) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 4-(1-chloro-5-methylimidazo[1,5-a]pyridin-3-yl)butanoic acid.
| Compound Name | 4-(1-chloro-5-methylimidazo[1,5-a]pyridin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 84742117 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-(1-chloro-5-methylimidazo[1,5-a]pyridin-3-yl)butanoic acid |
| SMILES | Cc1cccc2c(Cl)nc(CCCC(=O)O)n12 |
| InChI | InChI=1S/C12H13ClN2O2/c1-8-4-2-5-9-12(13)14-10(15(8)9)6-3-7-11(16)17/h2,4-5H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | AGLZXVABHKUTHF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |