About 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid
2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid (PubChem CID 83839544) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid |
| PubChem CID | 83839544 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid |
| SMILES | Cc1nc(Cl)c2cccc(CC(=O)O)n12 |
| InChI | InChI=1S/C10H9ClN2O2/c1-6-12-10(11)8-4-2-3-7(13(6)8)5-9(14)15/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | GRQOLDZJGVJVMZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid?
The IUPAC name of 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid (CID 83839544) is 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid.
What is the SMILES notation for 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid?
The canonical SMILES for 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid is Cc1nc(Cl)c2cccc(CC(=O)O)n12.
What is the InChIKey of 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid?
The InChIKey is GRQOLDZJGVJVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2/c1-6-12-10(11)8-4-2-3-7(13(6)8)5-9(14)15/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid?
2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid has a molecular weight of 224.65 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloro-3-methylimidazo[1,5-a]pyridin-5-yl)acetic acid is sourced from PubChem (CID 83839544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).