2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid

C10H10N2O2 — CID 83865927

IUPAC2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid
SMILESCc1cn2c(CC(=O)O)cccc2n1
InChIInChI=1S/C10H10N2O2/c1-7-6-12-8(5-10(13)14)3-2-4-9(12)11-7/h2-4,6H,5H2,1H3,(H,13,14)
InChIKeyJNVORRGQHXXVED-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.27
Rot. Bonds2

About 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid

2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid (PubChem CID 83865927) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid
PubChem CID83865927
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Name2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid
SMILESCc1cn2c(CC(=O)O)cccc2n1
InChIInChI=1S/C10H10N2O2/c1-7-6-12-8(5-10(13)14)3-2-4-9(12)11-7/h2-4,6H,5H2,1H3,(H,13,14)
InChIKeyJNVORRGQHXXVED-UHFFFAOYSA-N
XLogP1.27
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid?
The IUPAC name of 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid (CID 83865927) is 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid.
What is the SMILES notation for 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid?
The canonical SMILES for 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid is Cc1cn2c(CC(=O)O)cccc2n1.
What is the InChIKey of 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid?
The InChIKey is JNVORRGQHXXVED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-7-6-12-8(5-10(13)14)3-2-4-9(12)11-7/h2-4,6H,5H2,1H3,(H,13,14).
What are the key properties of 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid?
2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid has a molecular weight of 190.20 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylimidazo[1,2-a]pyridin-5-yl)acetic acid is sourced from PubChem (CID 83865927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).