C16H21ClN4 — CID 84744185
2-(4-chloro-2-phenyl-1H-imidazol-5-yl)-N-methyl-2-pyrrolidin-1-ylethanamine (PubChem CID 84744185) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is 2-(4-chloro-2-phenyl-1H-imidazol-5-yl)-N-methyl-2-pyrrolidin-1-ylethanamine.
| Compound Name | 2-(4-chloro-2-phenyl-1H-imidazol-5-yl)-N-methyl-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 84744185 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(4-chloro-2-phenyl-1H-imidazol-5-yl)-N-methyl-2-pyrrolidin-1-ylethanamine |
| SMILES | CNCC(c1[nH]c(-c2ccccc2)nc1Cl)N1CCCC1 |
| InChI | InChI=1S/C16H21ClN4/c1-18-11-13(21-9-5-6-10-21)14-15(17)20-16(19-14)12-7-3-2-4-8-12/h2-4,7-8,13,18H,5-6,9-11H2,1H3,(H,19,20) |
| InChIKey | SJMQBLHKSNWCFP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |