C10H13ClN4 — CID 84740448
2-(4-chloro-2-methyl-1H-imidazol-5-yl)-2-pyrrolidin-1-ylacetonitrile (PubChem CID 84740448) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is 2-(4-chloro-2-methyl-1H-imidazol-5-yl)-2-pyrrolidin-1-ylacetonitrile.
| Compound Name | 2-(4-chloro-2-methyl-1H-imidazol-5-yl)-2-pyrrolidin-1-ylacetonitrile |
|---|---|
| PubChem CID | 84740448 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-(4-chloro-2-methyl-1H-imidazol-5-yl)-2-pyrrolidin-1-ylacetonitrile |
| SMILES | Cc1nc(Cl)c(C(C#N)N2CCCC2)[nH]1 |
| InChI | InChI=1S/C10H13ClN4/c1-7-13-9(10(11)14-7)8(6-12)15-4-2-3-5-15/h8H,2-5H2,1H3,(H,13,14) |
| InChIKey | WVLKMXQDBBHSLX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |