C16H28ClN5 — CID 84744809
2-(5-chloro-3-methylimidazol-4-yl)-2-(4-cyclopentylpiperazin-1-yl)-N-methylethanamine (PubChem CID 84744809) has the molecular formula C16H28ClN5 and a molecular weight of 325.89 g/mol. Its IUPAC name is 2-(5-chloro-3-methylimidazol-4-yl)-2-(4-cyclopentylpiperazin-1-yl)-N-methylethanamine.
| Compound Name | 2-(5-chloro-3-methylimidazol-4-yl)-2-(4-cyclopentylpiperazin-1-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 84744809 |
| Molecular Formula | C16H28ClN5 |
| Molecular Weight | 325.89 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-(5-chloro-3-methylimidazol-4-yl)-2-(4-cyclopentylpiperazin-1-yl)-N-methylethanamine |
| SMILES | CNCC(c1c(Cl)ncn1C)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H28ClN5/c1-18-11-14(15-16(17)19-12-20(15)2)22-9-7-21(8-10-22)13-5-3-4-6-13/h12-14,18H,3-11H2,1-2H3 |
| InChIKey | GYZRPAOYVZVFAK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.89 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |