C21H28N4O2 — CID 84745614
2-(4-cyclopentylpiperazin-1-yl)-2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetic acid (PubChem CID 84745614) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-(4-cyclopentylpiperazin-1-yl)-2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetic acid.
| Compound Name | 2-(4-cyclopentylpiperazin-1-yl)-2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 84745614 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-(4-cyclopentylpiperazin-1-yl)-2-(5-methyl-2-phenyl-1H-imidazol-4-yl)acetic acid |
| SMILES | Cc1[nH]c(-c2ccccc2)nc1C(C(=O)O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-15-18(23-20(22-15)16-7-3-2-4-8-16)19(21(26)27)25-13-11-24(12-14-25)17-9-5-6-10-17/h2-4,7-8,17,19H,5-6,9-14H2,1H3,(H,22,23)(H,26,27) |
| InChIKey | AJCHPEFWJWJNMN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |