C15H19N3OS — CID 84750157
2-(4-hydroxypiperidin-1-yl)-2-(1H-indol-3-yl)ethanethioamide (PubChem CID 84750157) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-2-(1H-indol-3-yl)ethanethioamide.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-2-(1H-indol-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 84750157 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-2-(1H-indol-3-yl)ethanethioamide |
| SMILES | NC(=S)C(c1c[nH]c2ccccc12)N1CCC(O)CC1 |
| InChI | InChI=1S/C15H19N3OS/c16-15(20)14(18-7-5-10(19)6-8-18)12-9-17-13-4-2-1-3-11(12)13/h1-4,9-10,14,17,19H,5-8H2,(H2,16,20) |
| InChIKey | ZIAVXYAPTWRROJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|