1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate

C13H8N2O5S — CID 847553

IUPAC1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate
SMILESO=C(OCc1nc2ccccc2s1)c1ccc([N+](=O)[O-])o1
InChIInChI=1S/C13H8N2O5S/c16-13(9-5-6-12(20-9)15(17)18)19-7-11-14-8-3-1-2-4-10(8)21-11/h1-6H,7H2
InChIKeyJMYJZUIPWFBXPI-UHFFFAOYSA-N
MW304.28 g/mol
LogP3.15
Rot. Bonds4

About 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate

1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate (PubChem CID 847553) has the molecular formula C13H8N2O5S and a molecular weight of 304.28 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate
PubChem CID847553
Molecular FormulaC13H8N2O5S
Molecular Weight304.28 g/mol
Exact Mass304.02
IUPAC Name1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate
SMILESO=C(OCc1nc2ccccc2s1)c1ccc([N+](=O)[O-])o1
InChIInChI=1S/C13H8N2O5S/c16-13(9-5-6-12(20-9)15(17)18)19-7-11-14-8-3-1-2-4-10(8)21-11/h1-6H,7H2
InChIKeyJMYJZUIPWFBXPI-UHFFFAOYSA-N
XLogP3.15
TPSA95.47 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.28
LogP ≤ 53.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate (CID 847553) is 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate is O=C(OCc1nc2ccccc2s1)c1ccc([N+](=O)[O-])o1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate?
The InChIKey is JMYJZUIPWFBXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O5S/c16-13(9-5-6-12(20-9)15(17)18)19-7-11-14-8-3-1-2-4-10(8)21-11/h1-6H,7H2.
What are the key properties of 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate?
1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate has a molecular weight of 304.28 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl 5-nitrofuran-2-carboxylate is sourced from PubChem (CID 847553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).