C14H9N3O6S — CID 2350758
[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2350758) has the molecular formula C14H9N3O6S and a molecular weight of 347.31 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2350758 |
| Molecular Formula | C14H9N3O6S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])o1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H9N3O6S/c18-11(16-14-15-8-3-1-2-4-10(8)24-14)7-22-13(19)9-5-6-12(23-9)17(20)21/h1-6H,7H2,(H,15,16,18) |
| InChIKey | YMPQFKRHAIWZFT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|