C12H5F3N2O2S — CID 2445991
N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 2445991) has the molecular formula C12H5F3N2O2S and a molecular weight of 298.25 g/mol. Its IUPAC name is N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2445991 |
| Molecular Formula | C12H5F3N2O2S |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1nc2c(F)c(F)c(F)cc2s1)c1ccco1 |
| InChI | InChI=1S/C12H5F3N2O2S/c13-5-4-7-10(9(15)8(5)14)16-12(20-7)17-11(18)6-2-1-3-19-6/h1-4H,(H,16,17,18) |
| InChIKey | ZKQCCNKYYIXCEG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|