C17H22N2O2 — CID 84756737
ethyl 1-[cyano-(3-methylphenyl)methyl]piperidine-4-carboxylate (PubChem CID 84756737) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is ethyl 1-[cyano-(3-methylphenyl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[cyano-(3-methylphenyl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 84756737 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethyl 1-[cyano-(3-methylphenyl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(C#N)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C17H22N2O2/c1-3-21-17(20)14-7-9-19(10-8-14)16(12-18)15-6-4-5-13(2)11-15/h4-6,11,14,16H,3,7-10H2,1-2H3 |
| InChIKey | OOMJORYJZKCPCM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |