C13H16Cl2N2 — CID 84757701
2-[butyl(methyl)amino]-2-(2,4-dichlorophenyl)acetonitrile (PubChem CID 84757701) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-2-(2,4-dichlorophenyl)acetonitrile.
| Compound Name | 2-[butyl(methyl)amino]-2-(2,4-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 84757701 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[butyl(methyl)amino]-2-(2,4-dichlorophenyl)acetonitrile |
| SMILES | CCCCN(C)C(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2/c1-3-4-7-17(2)13(9-16)11-6-5-10(14)8-12(11)15/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | UZVKVQXSSHOWFO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |