C7H8N4S — CID 84768192
2-(4-amino-2-methylsulfanylpyrimidin-5-yl)acetonitrile (PubChem CID 84768192) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 2-(4-amino-2-methylsulfanylpyrimidin-5-yl)acetonitrile.
| Compound Name | 2-(4-amino-2-methylsulfanylpyrimidin-5-yl)acetonitrile |
|---|---|
| PubChem CID | 84768192 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(4-amino-2-methylsulfanylpyrimidin-5-yl)acetonitrile |
| SMILES | CSc1ncc(CC#N)c(N)n1 |
| InChI | InChI=1S/C7H8N4S/c1-12-7-10-4-5(2-3-8)6(9)11-7/h4H,2H2,1H3,(H2,9,10,11) |
| InChIKey | WDVSLJCQVBJERQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |