C11H11N3 — CID 84769737
2-(2,3-dimethylbenzimidazol-5-yl)acetonitrile (PubChem CID 84769737) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(2,3-dimethylbenzimidazol-5-yl)acetonitrile.
| Compound Name | 2-(2,3-dimethylbenzimidazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 84769737 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(2,3-dimethylbenzimidazol-5-yl)acetonitrile |
| SMILES | Cc1nc2ccc(CC#N)cc2n1C |
| InChI | InChI=1S/C11H11N3/c1-8-13-10-4-3-9(5-6-12)7-11(10)14(8)2/h3-4,7H,5H2,1-2H3 |
| InChIKey | RGTYKDSKBDNPID-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |