2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid

C12H13NO3 — CID 84786549

IUPAC2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)c1cc2ncccc2o1
InChIInChI=1S/C12H13NO3/c1-7(2)11(12(14)15)10-6-8-9(16-10)4-3-5-13-8/h3-7,11H,1-2H3,(H,14,15)
InChIKeyHFBNHNOJVWKXGC-UHFFFAOYSA-N
MW219.24 g/mol
LogP2.65
Rot. Bonds3

About 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid

2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid (PubChem CID 84786549) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid.

Molecular Properties

Compound Name2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid
PubChem CID84786549
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Name2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)c1cc2ncccc2o1
InChIInChI=1S/C12H13NO3/c1-7(2)11(12(14)15)10-6-8-9(16-10)4-3-5-13-8/h3-7,11H,1-2H3,(H,14,15)
InChIKeyHFBNHNOJVWKXGC-UHFFFAOYSA-N
XLogP2.65
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid?
The IUPAC name of 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid (CID 84786549) is 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid.
What is the SMILES notation for 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid?
The canonical SMILES for 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid is CC(C)C(C(=O)O)c1cc2ncccc2o1.
What is the InChIKey of 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid?
The InChIKey is HFBNHNOJVWKXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-7(2)11(12(14)15)10-6-8-9(16-10)4-3-5-13-8/h3-7,11H,1-2H3,(H,14,15).
What are the key properties of 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid?
2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid has a molecular weight of 219.24 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-furo[3,2-b]pyridin-2-yl-3-methylbutanoic acid is sourced from PubChem (CID 84786549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).