C8H6N2O4S — CID 84790864
3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylic acid (PubChem CID 84790864) has the molecular formula C8H6N2O4S and a molecular weight of 226.21 g/mol. Its IUPAC name is 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylic acid.
| Compound Name | 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 84790864 |
| Molecular Formula | C8H6N2O4S |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 3-amino-1,1-dioxo-1,2-benzothiazole-6-carboxylic acid |
| SMILES | NC1=NS(=O)(=O)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C8H6N2O4S/c9-7-5-2-1-4(8(11)12)3-6(5)15(13,14)10-7/h1-3H,(H2,9,10)(H,11,12) |
| InChIKey | LCMWACCLANLKBH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |