C11H15F2NS — CID 84794692
2-[2-(2,2-difluoroethylsulfanyl)phenyl]propan-1-amine (PubChem CID 84794692) has the molecular formula C11H15F2NS and a molecular weight of 231.31 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethylsulfanyl)phenyl]propan-1-amine.
| Compound Name | 2-[2-(2,2-difluoroethylsulfanyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 84794692 |
| Molecular Formula | C11H15F2NS |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[2-(2,2-difluoroethylsulfanyl)phenyl]propan-1-amine |
| SMILES | CC(CN)c1ccccc1SCC(F)F |
| InChI | InChI=1S/C11H15F2NS/c1-8(6-14)9-4-2-3-5-10(9)15-7-11(12)13/h2-5,8,11H,6-7,14H2,1H3 |
| InChIKey | IWSQZXXLRKIHLG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |