2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid

C10H11F2NO2S — CID 84803321

IUPAC2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid
SMILESNC(C(=O)O)c1ccccc1SCC(F)F
InChIInChI=1S/C10H11F2NO2S/c11-8(12)5-16-7-4-2-1-3-6(7)9(13)10(14)15/h1-4,8-9H,5,13H2,(H,14,15)
InChIKeyFZYKIIYSCOLWHR-UHFFFAOYSA-N
MW247.27 g/mol
LogP2.13
Rot. Bonds5

About 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid

2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid (PubChem CID 84803321) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid.

Molecular Properties

Compound Name2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid
PubChem CID84803321
Molecular FormulaC10H11F2NO2S
Molecular Weight247.27 g/mol
Exact Mass247.05
IUPAC Name2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid
SMILESNC(C(=O)O)c1ccccc1SCC(F)F
InChIInChI=1S/C10H11F2NO2S/c11-8(12)5-16-7-4-2-1-3-6(7)9(13)10(14)15/h1-4,8-9H,5,13H2,(H,14,15)
InChIKeyFZYKIIYSCOLWHR-UHFFFAOYSA-N
XLogP2.13
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.27
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid?
The IUPAC name of 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid (CID 84803321) is 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid.
What is the SMILES notation for 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid?
The canonical SMILES for 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid is NC(C(=O)O)c1ccccc1SCC(F)F.
What is the InChIKey of 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid?
The InChIKey is FZYKIIYSCOLWHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2S/c11-8(12)5-16-7-4-2-1-3-6(7)9(13)10(14)15/h1-4,8-9H,5,13H2,(H,14,15).
What are the key properties of 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid?
2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid has a molecular weight of 247.27 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[2-(2,2-difluoroethylsulfanyl)phenyl]acetic acid is sourced from PubChem (CID 84803321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).