C10H10F2OS — CID 84681777
1-[2-(2,2-difluoroethylsulfanyl)phenyl]ethanone (PubChem CID 84681777) has the molecular formula C10H10F2OS and a molecular weight of 216.25 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethylsulfanyl)phenyl]ethanone.
| Compound Name | 1-[2-(2,2-difluoroethylsulfanyl)phenyl]ethanone |
|---|---|
| PubChem CID | 84681777 |
| Molecular Formula | C10H10F2OS |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1-[2-(2,2-difluoroethylsulfanyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1SCC(F)F |
| InChI | InChI=1S/C10H10F2OS/c1-7(13)8-4-2-3-5-9(8)14-6-10(11)12/h2-5,10H,6H2,1H3 |
| InChIKey | XFVACZRIUDHUIJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |