C7H6ClN3O2S — CID 84795007
2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride (PubChem CID 84795007) has the molecular formula C7H6ClN3O2S and a molecular weight of 231.66 g/mol. Its IUPAC name is 2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride.
| Compound Name | 2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride |
|---|---|
| PubChem CID | 84795007 |
| Molecular Formula | C7H6ClN3O2S |
| Molecular Weight | 231.66 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-methylpyrazolo[1,5-a]pyrimidine-6-sulfonyl chloride |
| SMILES | Cc1cc2ncc(S(=O)(=O)Cl)cn2n1 |
| InChI | InChI=1S/C7H6ClN3O2S/c1-5-2-7-9-3-6(14(8,12)13)4-11(7)10-5/h2-4H,1H3 |
| InChIKey | XABYQTGESXYFNZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |