About 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride
2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride (PubChem CID 83823970) has the molecular formula C7H6ClN3O2S
and a molecular weight of 231.66 g/mol. Its IUPAC name is 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride.
Analyze 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride?
The IUPAC name of 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride (CID 83823970) is 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride.
What is the SMILES notation for 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride?
The canonical SMILES for 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride is Cc1nc2ccc(S(=O)(=O)Cl)cn2n1.
What is the InChIKey of 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride?
The InChIKey is GPLOLBAYSVJIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O2S/c1-5-9-7-3-2-6(14(8,12)13)4-11(7)10-5/h2-4H,1H3.
What are the key properties of 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride?
2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride has a molecular weight of 231.66 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-sulfonyl chloride is sourced from PubChem (CID 83823970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).