C10H14F2N2S — CID 84795516
5-(1,1-difluoroethyl)-2-piperidin-4-yl-1,3-thiazole (PubChem CID 84795516) has the molecular formula C10H14F2N2S and a molecular weight of 232.30 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-piperidin-4-yl-1,3-thiazole.
| Compound Name | 5-(1,1-difluoroethyl)-2-piperidin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 84795516 |
| Molecular Formula | C10H14F2N2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-piperidin-4-yl-1,3-thiazole |
| SMILES | CC(F)(F)c1cnc(C2CCNCC2)s1 |
| InChI | InChI=1S/C10H14F2N2S/c1-10(11,12)8-6-14-9(15-8)7-2-4-13-5-3-7/h6-7,13H,2-5H2,1H3 |
| InChIKey | NPFXRAAKJJYTKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |