C7H6F3N5O — CID 84795834
N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine (PubChem CID 84795834) has the molecular formula C7H6F3N5O and a molecular weight of 233.15 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine.
| Compound Name | N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 84795834 |
| Molecular Formula | C7H6F3N5O |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine |
| SMILES | ONCc1cnc2nc(C(F)(F)F)nn2c1 |
| InChI | InChI=1S/C7H6F3N5O/c8-7(9,10)5-13-6-11-1-4(2-12-16)3-15(6)14-5/h1,3,12,16H,2H2 |
| InChIKey | PTMZAARFKFJMLD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|