C9H7ClN2O2S — CID 84801776
1,6-naphthyridin-3-ylmethanesulfonyl chloride (PubChem CID 84801776) has the molecular formula C9H7ClN2O2S and a molecular weight of 242.69 g/mol. Its IUPAC name is 1,6-naphthyridin-3-ylmethanesulfonyl chloride.
| Compound Name | 1,6-naphthyridin-3-ylmethanesulfonyl chloride |
|---|---|
| PubChem CID | 84801776 |
| Molecular Formula | C9H7ClN2O2S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1,6-naphthyridin-3-ylmethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1cnc2ccncc2c1 |
| InChI | InChI=1S/C9H7ClN2O2S/c10-15(13,14)6-7-3-8-5-11-2-1-9(8)12-4-7/h1-5H,6H2 |
| InChIKey | BFCXNBFNFCQLGB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |