C11H22N2O2S — CID 84803204
tert-butyl N-[(3-aminothian-3-yl)methyl]carbamate (PubChem CID 84803204) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is tert-butyl N-[(3-aminothian-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-aminothian-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 84803204 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | tert-butyl N-[(3-aminothian-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(N)CCCSC1 |
| InChI | InChI=1S/C11H22N2O2S/c1-10(2,3)15-9(14)13-7-11(12)5-4-6-16-8-11/h4-8,12H2,1-3H3,(H,13,14) |
| InChIKey | STCOYLAIOPQZIP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |