C8H8F3N5O — CID 84803299
N-methyl-N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine (PubChem CID 84803299) has the molecular formula C8H8F3N5O and a molecular weight of 247.18 g/mol. Its IUPAC name is N-methyl-N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine.
| Compound Name | N-methyl-N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 84803299 |
| Molecular Formula | C8H8F3N5O |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-methyl-N-[[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]methyl]hydroxylamine |
| SMILES | CN(O)Cc1cnc2nc(C(F)(F)F)nn2c1 |
| InChI | InChI=1S/C8H8F3N5O/c1-15(17)3-5-2-12-7-13-6(8(9,10)11)14-16(7)4-5/h2,4,17H,3H2,1H3 |
| InChIKey | QSDIJXVPIPPPFM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|