C11H18F2O2S — CID 84804267
3,3-difluoro-4-(3-methylbutyl)thiane-4-carboxylic acid (PubChem CID 84804267) has the molecular formula C11H18F2O2S and a molecular weight of 252.33 g/mol. Its IUPAC name is 3,3-difluoro-4-(3-methylbutyl)thiane-4-carboxylic acid.
| Compound Name | 3,3-difluoro-4-(3-methylbutyl)thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 84804267 |
| Molecular Formula | C11H18F2O2S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3,3-difluoro-4-(3-methylbutyl)thiane-4-carboxylic acid |
| SMILES | CC(C)CCC1(C(=O)O)CCSCC1(F)F |
| InChI | InChI=1S/C11H18F2O2S/c1-8(2)3-4-10(9(14)15)5-6-16-7-11(10,12)13/h8H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | VSQLSLMUOSHMLH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |