3-ethyl-4,4-difluorothiane-3-carboxylic acid

C8H12F2O2S — CID 84781203

IUPAC3-ethyl-4,4-difluorothiane-3-carboxylic acid
SMILESCCC1(C(=O)O)CSCCC1(F)F
InChIInChI=1S/C8H12F2O2S/c1-2-7(6(11)12)5-13-4-3-8(7,9)10/h2-5H2,1H3,(H,11,12)
InChIKeyZOKRHGOJXGUFPQ-UHFFFAOYSA-N
MW210.24 g/mol
LogP2.24
Rot. Bonds2

About 3-ethyl-4,4-difluorothiane-3-carboxylic acid

3-ethyl-4,4-difluorothiane-3-carboxylic acid (PubChem CID 84781203) has the molecular formula C8H12F2O2S and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-ethyl-4,4-difluorothiane-3-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-4,4-difluorothiane-3-carboxylic acid
PubChem CID84781203
Molecular FormulaC8H12F2O2S
Molecular Weight210.24 g/mol
Exact Mass210.05
IUPAC Name3-ethyl-4,4-difluorothiane-3-carboxylic acid
SMILESCCC1(C(=O)O)CSCCC1(F)F
InChIInChI=1S/C8H12F2O2S/c1-2-7(6(11)12)5-13-4-3-8(7,9)10/h2-5H2,1H3,(H,11,12)
InChIKeyZOKRHGOJXGUFPQ-UHFFFAOYSA-N
XLogP2.24
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.24
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-ethyl-4,4-difluorothiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(4,4-Difluorohexylsulfanyl)-4-methylpentanoic acid
CID 87339794
4-Methyl-2-(3,3,3-trifluoropropylsulfanyl)pentanoic acid
CID 87340196
2-(5,5-Difluorohexylsulfanyl)-4-methylpentanoic acid
CID 87340222
2-(4,4-Difluorohexylsulfanyl)-3,3-dimethylbutanoic acid
CID 87340489
4-Methyl-2-(6,6,6-trifluorohexylsulfanyl)pentanoic acid
CID 87340565
3,3-Dimethyl-2-(6,6,6-trifluorohexylsulfanyl)butanoic acid
CID 87340723
2-(5,5-Difluorohexylsulfanyl)-3,3-dimethylbutanoic acid
CID 87341179
2-(6,6-Difluorohexylsulfanyl)-4-methylpentanoic acid
CID 87341205
2-(6,6-Difluorohexylsulfanyl)-3,3-dimethylbutanoic acid
CID 87341733
2,2,4-Trimethyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)pentanoic acid
CID 164092057
4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecylsulfanyl)-2,2,4-trimethylpentanoic acid
CID 166867217
2-Ethylsulfanyl-5,5,5-trifluoro-4-methylpentanoic acid
CID 169993122

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-4,4-difluorothiane-3-carboxylic acid?
The IUPAC name of 3-ethyl-4,4-difluorothiane-3-carboxylic acid (CID 84781203) is 3-ethyl-4,4-difluorothiane-3-carboxylic acid.
What is the SMILES notation for 3-ethyl-4,4-difluorothiane-3-carboxylic acid?
The canonical SMILES for 3-ethyl-4,4-difluorothiane-3-carboxylic acid is CCC1(C(=O)O)CSCCC1(F)F.
What is the InChIKey of 3-ethyl-4,4-difluorothiane-3-carboxylic acid?
The InChIKey is ZOKRHGOJXGUFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O2S/c1-2-7(6(11)12)5-13-4-3-8(7,9)10/h2-5H2,1H3,(H,11,12).
What are the key properties of 3-ethyl-4,4-difluorothiane-3-carboxylic acid?
3-ethyl-4,4-difluorothiane-3-carboxylic acid has a molecular weight of 210.24 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,4-difluorothiane-3-carboxylic acid is sourced from PubChem (CID 84781203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).