2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid

C12H22F2O2S — CID 87341205

IUPAC2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid
SMILESCC(C)CC(SCCCCCC(F)F)C(=O)O
InChIInChI=1S/C12H22F2O2S/c1-9(2)8-10(12(15)16)17-7-5-3-4-6-11(13)14/h9-11H,3-8H2,1-2H3,(H,15,16)
InChIKeySVJSRRRZJFNWRJ-UHFFFAOYSA-N
MW268.37 g/mol
LogP4.04
Rot. Bonds10

About 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid

2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid (PubChem CID 87341205) has the molecular formula C12H22F2O2S and a molecular weight of 268.37 g/mol. Its IUPAC name is 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid
PubChem CID87341205
Molecular FormulaC12H22F2O2S
Molecular Weight268.37 g/mol
Exact Mass268.13
IUPAC Name2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid
SMILESCC(C)CC(SCCCCCC(F)F)C(=O)O
InChIInChI=1S/C12H22F2O2S/c1-9(2)8-10(12(15)16)17-7-5-3-4-6-11(13)14/h9-11H,3-8H2,1-2H3,(H,15,16)
InChIKeySVJSRRRZJFNWRJ-UHFFFAOYSA-N
XLogP4.04
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.37
LogP ≤ 54.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid?
The IUPAC name of 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid (CID 87341205) is 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid.
What is the SMILES notation for 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid?
The canonical SMILES for 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid is CC(C)CC(SCCCCCC(F)F)C(=O)O.
What is the InChIKey of 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid?
The InChIKey is SVJSRRRZJFNWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2O2S/c1-9(2)8-10(12(15)16)17-7-5-3-4-6-11(13)14/h9-11H,3-8H2,1-2H3,(H,15,16).
What are the key properties of 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid?
2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid has a molecular weight of 268.37 g/mol, XLogP of 4.04, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid is sourced from PubChem (CID 87341205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).