C15H25F5O2S — CID 142648287
2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid (PubChem CID 142648287) has the molecular formula C15H25F5O2S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid.
| Compound Name | 2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid |
|---|---|
| PubChem CID | 142648287 |
| Molecular Formula | C15H25F5O2S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoic acid |
| SMILES | CCCCC(CCCCSCCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H25F5O2S/c1-2-3-7-12(13(21)22)8-4-5-10-23-11-6-9-14(16,17)15(18,19)20/h12H,2-11H2,1H3,(H,21,22) |
| InChIKey | HNYVEEMVZMHTLT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|