C10H12Cl2O2S — CID 84808045
2-(5-chloro-2,4-dimethylphenyl)ethanesulfonyl chloride (PubChem CID 84808045) has the molecular formula C10H12Cl2O2S and a molecular weight of 267.18 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethylphenyl)ethanesulfonyl chloride.
| Compound Name | 2-(5-chloro-2,4-dimethylphenyl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 84808045 |
| Molecular Formula | C10H12Cl2O2S |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-(5-chloro-2,4-dimethylphenyl)ethanesulfonyl chloride |
| SMILES | Cc1cc(C)c(CCS(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O2S/c1-7-5-8(2)10(11)6-9(7)3-4-15(12,13)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | CYQYYYUMAGEGKM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |