C8H16F3N3O2S — CID 84810696
3-[1,1-dioxo-5-(2,2,2-trifluoroethyl)-1,2,5-thiadiazolidin-2-yl]-N-methylpropan-1-amine (PubChem CID 84810696) has the molecular formula C8H16F3N3O2S and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[1,1-dioxo-5-(2,2,2-trifluoroethyl)-1,2,5-thiadiazolidin-2-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1,1-dioxo-5-(2,2,2-trifluoroethyl)-1,2,5-thiadiazolidin-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 84810696 |
| Molecular Formula | C8H16F3N3O2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[1,1-dioxo-5-(2,2,2-trifluoroethyl)-1,2,5-thiadiazolidin-2-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1CCN(CC(F)(F)F)S1(=O)=O |
| InChI | InChI=1S/C8H16F3N3O2S/c1-12-3-2-4-13-5-6-14(17(13,15)16)7-8(9,10)11/h12H,2-7H2,1H3 |
| InChIKey | GACSPRDXAJBKKW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|