C13H18ClNO2S — CID 84814132
[5-(3-chlorophenyl)-1,1-dioxothiepan-4-yl]methanamine (PubChem CID 84814132) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-1,1-dioxothiepan-4-yl]methanamine.
| Compound Name | [5-(3-chlorophenyl)-1,1-dioxothiepan-4-yl]methanamine |
|---|---|
| PubChem CID | 84814132 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | [5-(3-chlorophenyl)-1,1-dioxothiepan-4-yl]methanamine |
| SMILES | NCC1CCS(=O)(=O)CCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO2S/c14-12-3-1-2-10(8-12)13-5-7-18(16,17)6-4-11(13)9-15/h1-3,8,11,13H,4-7,9,15H2 |
| InChIKey | RQTAANBPUSKHPT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |