C12H17NO3S — CID 84805000
4-[3-(aminomethyl)-1,1-dioxothian-4-yl]phenol (PubChem CID 84805000) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-1,1-dioxothian-4-yl]phenol.
| Compound Name | 4-[3-(aminomethyl)-1,1-dioxothian-4-yl]phenol |
|---|---|
| PubChem CID | 84805000 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-[3-(aminomethyl)-1,1-dioxothian-4-yl]phenol |
| SMILES | NCC1CS(=O)(=O)CCC1c1ccc(O)cc1 |
| InChI | InChI=1S/C12H17NO3S/c13-7-10-8-17(15,16)6-5-12(10)9-1-3-11(14)4-2-9/h1-4,10,12,14H,5-8,13H2 |
| InChIKey | MDVCJMUXKWCSSR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |