C13H21N3S — CID 84817353
2-[3-(diethylamino)propylamino]-2-thiophen-3-ylacetonitrile (PubChem CID 84817353) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-[3-(diethylamino)propylamino]-2-thiophen-3-ylacetonitrile.
| Compound Name | 2-[3-(diethylamino)propylamino]-2-thiophen-3-ylacetonitrile |
|---|---|
| PubChem CID | 84817353 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[3-(diethylamino)propylamino]-2-thiophen-3-ylacetonitrile |
| SMILES | CCN(CC)CCCNC(C#N)c1ccsc1 |
| InChI | InChI=1S/C13H21N3S/c1-3-16(4-2)8-5-7-15-13(10-14)12-6-9-17-11-12/h6,9,11,13,15H,3-5,7-8H2,1-2H3 |
| InChIKey | FHQLZAVWHBFQEU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|