C11H16N2S — CID 84817819
2-(3-methylbutylamino)-2-thiophen-3-ylacetonitrile (PubChem CID 84817819) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-2-thiophen-3-ylacetonitrile.
| Compound Name | 2-(3-methylbutylamino)-2-thiophen-3-ylacetonitrile |
|---|---|
| PubChem CID | 84817819 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(3-methylbutylamino)-2-thiophen-3-ylacetonitrile |
| SMILES | CC(C)CCNC(C#N)c1ccsc1 |
| InChI | InChI=1S/C11H16N2S/c1-9(2)3-5-13-11(7-12)10-4-6-14-8-10/h4,6,8-9,11,13H,3,5H2,1-2H3 |
| InChIKey | UXRNGNRUAHLTRN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |