C16H24N2O3 — CID 82020046
2-(3-methylbutylamino)-2-(3,4,5-trimethoxyphenyl)acetonitrile (PubChem CID 82020046) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-2-(3,4,5-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-(3-methylbutylamino)-2-(3,4,5-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 82020046 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-(3-methylbutylamino)-2-(3,4,5-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(C(C#N)NCCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)6-7-18-13(10-17)12-8-14(19-3)16(21-5)15(9-12)20-4/h8-9,11,13,18H,6-7H2,1-5H3 |
| InChIKey | MQAISTNLQXNCLC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |