C12H10ClNO4 — CID 84817968
methyl (2Z)-2-(6-chloro-4-methyl-2-oxo-1,4-benzoxazin-3-ylidene)acetate (PubChem CID 84817968) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is methyl (2Z)-2-(6-chloro-4-methyl-2-oxo-1,4-benzoxazin-3-ylidene)acetate.
| Compound Name | methyl (2Z)-2-(6-chloro-4-methyl-2-oxo-1,4-benzoxazin-3-ylidene)acetate |
|---|---|
| PubChem CID | 84817968 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | methyl (2Z)-2-(6-chloro-4-methyl-2-oxo-1,4-benzoxazin-3-ylidene)acetate |
| SMILES | COC(=O)/C=C1/C(=O)Oc2ccc(Cl)cc2N1C |
| InChI | InChI=1S/C12H10ClNO4/c1-14-8-5-7(13)3-4-10(8)18-12(16)9(14)6-11(15)17-2/h3-6H,1-2H3/b9-6- |
| InChIKey | ZDOGZZNDJQTSLG-TWGQIWQCSA-N |
| XLogP | 1.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|