C16H20N2O3S — CID 84818082
3-[5-ethoxy-3-(1,3-thiazolidin-2-yl)indol-1-yl]propanoic acid (PubChem CID 84818082) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-[5-ethoxy-3-(1,3-thiazolidin-2-yl)indol-1-yl]propanoic acid.
| Compound Name | 3-[5-ethoxy-3-(1,3-thiazolidin-2-yl)indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 84818082 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-[5-ethoxy-3-(1,3-thiazolidin-2-yl)indol-1-yl]propanoic acid |
| SMILES | CCOc1ccc2c(c1)c(C1NCCS1)cn2CCC(=O)O |
| InChI | InChI=1S/C16H20N2O3S/c1-2-21-11-3-4-14-12(9-11)13(16-17-6-8-22-16)10-18(14)7-5-15(19)20/h3-4,9-10,16-17H,2,5-8H2,1H3,(H,19,20) |
| InChIKey | PFBOSQSOJYIERF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |