C13H15NO2 — CID 849761
(2S)-2-methyl-4-(4-methylanilino)-2,3-dihydropyran-6-one (PubChem CID 849761) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (2S)-2-methyl-4-(4-methylanilino)-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-methyl-4-(4-methylanilino)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 849761 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2S)-2-methyl-4-(4-methylanilino)-2,3-dihydropyran-6-one |
| SMILES | Cc1ccc(NC2=CC(=O)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C13H15NO2/c1-9-3-5-11(6-4-9)14-12-7-10(2)16-13(15)8-12/h3-6,8,10,14H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | BMXLBENZQWZURO-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |