C20H24N2O3 — CID 85054999
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-3-pyridin-3-ylprop-2-enamide (PubChem CID 85054999) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 85054999 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethyl-3-pyridin-3-ylprop-2-enamide |
| SMILES | CCN(CCc1ccc(OC)c(OC)c1)C(=O)C=Cc1cccnc1 |
| InChI | InChI=1S/C20H24N2O3/c1-4-22(20(23)10-8-17-6-5-12-21-15-17)13-11-16-7-9-18(24-2)19(14-16)25-3/h5-10,12,14-15H,4,11,13H2,1-3H3 |
| InChIKey | XNOLRUXYERNELR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|