C20H27N3O2S — CID 85055232
N-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylbutan-1-imine (PubChem CID 85055232) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylbutan-1-imine.
| Compound Name | N-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylbutan-1-imine |
|---|---|
| PubChem CID | 85055232 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylbutan-1-imine |
| SMILES | CON=C(CCCN1CCN(c2ccccc2OC)CC1)c1cccs1 |
| InChI | InChI=1S/C20H27N3O2S/c1-24-19-9-4-3-8-18(19)23-14-12-22(13-15-23)11-5-7-17(21-25-2)20-10-6-16-26-20/h3-4,6,8-10,16H,5,7,11-15H2,1-2H3 |
| InChIKey | PWXWEGRJXBSXJY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|