C19H20N2O4S2 — CID 8506625
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate (PubChem CID 8506625) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 8506625 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
| SMILES | O=C(COC(=O)CSCc1cccs1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C19H20N2O4S2/c22-17(10-25-18(23)12-26-11-14-4-3-9-27-14)21-16-6-2-1-5-15(16)19(24)20-13-7-8-13/h1-6,9,13H,7-8,10-12H2,(H,20,24)(H,21,22) |
| InChIKey | SYLFWKQBZYHKDU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |