C33H54O11 — CID 85066906
4,6,8,10,12,13,14,25-octahydroxy-3-(1-hydroxyhexyl)-15,26-dimethyl-1-oxacyclohexacosa-15,17,19,21,23-pentaen-2-one (PubChem CID 85066906) has the molecular formula C33H54O11 and a molecular weight of 626.78 g/mol. Its IUPAC name is 4,6,8,10,12,13,14,25-octahydroxy-3-(1-hydroxyhexyl)-15,26-dimethyl-1-oxacyclohexacosa-15,17,19,21,23-pentaen-2-one.
| Compound Name | 4,6,8,10,12,13,14,25-octahydroxy-3-(1-hydroxyhexyl)-15,26-dimethyl-1-oxacyclohexacosa-15,17,19,21,23-pentaen-2-one |
|---|---|
| PubChem CID | 85066906 |
| Molecular Formula | C33H54O11 |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.37 |
| IUPAC Name | 4,6,8,10,12,13,14,25-octahydroxy-3-(1-hydroxyhexyl)-15,26-dimethyl-1-oxacyclohexacosa-15,17,19,21,23-pentaen-2-one |
| SMILES | CCCCCC(O)C1C(=O)OC(C)C(O)C=CC=CC=CC=CC=C(C)C(O)C(O)C(O)CC(O)CC(O)CC(O)CC1O |
| InChI | InChI=1S/C33H54O11/c1-4-5-11-16-27(38)30-28(39)19-24(35)17-23(34)18-25(36)20-29(40)32(42)31(41)21(2)14-12-9-7-6-8-10-13-15-26(37)22(3)44-33(30)43/h6-10,12-15,22-32,34-42H,4-5,11,16-20H2,1-3H3 |
| InChIKey | MHCJJKFRVNUEFV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 208.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|