C26H30ClN3O5S — CID 85090201
2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[2-(4-hydroxyoxan-4-yl)ethynyl]pyrazin-2-yl]propanamide (PubChem CID 85090201) has the molecular formula C26H30ClN3O5S and a molecular weight of 532.06 g/mol. Its IUPAC name is 2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[2-(4-hydroxyoxan-4-yl)ethynyl]pyrazin-2-yl]propanamide.
| Compound Name | 2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[2-(4-hydroxyoxan-4-yl)ethynyl]pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 85090201 |
| Molecular Formula | C26H30ClN3O5S |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentyl-N-[5-[2-(4-hydroxyoxan-4-yl)ethynyl]pyrazin-2-yl]propanamide |
| SMILES | CS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2cnc(C#CC3(O)CCOCC3)cn2)cc1Cl |
| InChI | InChI=1S/C26H30ClN3O5S/c1-36(33,34)23-7-6-19(15-22(23)27)21(14-18-4-2-3-5-18)25(31)30-24-17-28-20(16-29-24)8-9-26(32)10-12-35-13-11-26/h6-7,15-18,21,32H,2-5,10-14H2,1H3,(H,29,30,31) |
| InChIKey | HMKMFIZHKJWYTI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|