C29H36O5 — CID 85096585
10-hydroxy-5,9-dimethyl-14-methylidene-15-(3-phenylprop-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 85096585) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 10-hydroxy-5,9-dimethyl-14-methylidene-15-(3-phenylprop-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | 10-hydroxy-5,9-dimethyl-14-methylidene-15-(3-phenylprop-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 85096585 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 10-hydroxy-5,9-dimethyl-14-methylidene-15-(3-phenylprop-2-enoyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C=C1C2CCC3(O)C4(C)CCCC(C)(C(=O)O)C4CCC3(C2)C1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C29H36O5/c1-19-21-12-17-29(33)27(3)15-7-14-26(2,25(31)32)22(27)13-16-28(29,18-21)24(19)34-23(30)11-10-20-8-5-4-6-9-20/h4-6,8-11,21-22,24,33H,1,7,12-18H2,2-3H3,(H,31,32) |
| InChIKey | GZKHYVJXWLTZOY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|