C24H23ClN2O3 — CID 8510726
[(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8510726) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is [(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8510726 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](OC(=O)c2c(C)cc(C)nc2Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-14-10-11-15(2)19(12-14)27-23(28)21(18-8-6-5-7-9-18)30-24(29)20-16(3)13-17(4)26-22(20)25/h5-13,21H,1-4H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | APSRZWPAPQKORK-OAQYLSRUSA-N |
| XLogP | 5.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|