C21H30N2O3S2 — CID 8513429
(2S)-2-(1-adamantylsulfanyl)-N-[3-(dimethylsulfamoyl)phenyl]propanamide (PubChem CID 8513429) has the molecular formula C21H30N2O3S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is (2S)-2-(1-adamantylsulfanyl)-N-[3-(dimethylsulfamoyl)phenyl]propanamide.
| Compound Name | (2S)-2-(1-adamantylsulfanyl)-N-[3-(dimethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 8513429 |
| Molecular Formula | C21H30N2O3S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2S)-2-(1-adamantylsulfanyl)-N-[3-(dimethylsulfamoyl)phenyl]propanamide |
| SMILES | C[C@H](SC12CC3CC(CC(C3)C1)C2)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C21H30N2O3S2/c1-14(27-21-11-15-7-16(12-21)9-17(8-15)13-21)20(24)22-18-5-4-6-19(10-18)28(25,26)23(2)3/h4-6,10,14-17H,7-9,11-13H2,1-3H3,(H,22,24)/t14-,15?,16?,17?,21?/m0/s1 |
| InChIKey | MEGAGRNHOAVCQA-HILYYZTDSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |