C22H31NOS — CID 8513385
(2S)-2-(1-adamantylsulfanyl)-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 8513385) has the molecular formula C22H31NOS and a molecular weight of 357.56 g/mol. Its IUPAC name is (2S)-2-(1-adamantylsulfanyl)-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | (2S)-2-(1-adamantylsulfanyl)-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 8513385 |
| Molecular Formula | C22H31NOS |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2S)-2-(1-adamantylsulfanyl)-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)[C@H](C)SC23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C22H31NOS/c1-13-5-14(2)20(15(3)6-13)23-21(24)16(4)25-22-10-17-7-18(11-22)9-19(8-17)12-22/h5-6,16-19H,7-12H2,1-4H3,(H,23,24)/t16-,17?,18?,19?,22?/m0/s1 |
| InChIKey | VWPZOLXRXWPWNW-RMJOCGACSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |